About 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide
3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 42640876) has the molecular formula C15H13Cl2F3N2O3S
and a molecular weight of 429.25 g/mol. Its IUPAC name is 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide |
| PubChem CID | 42640876 |
| Molecular Formula | C15H13Cl2F3N2O3S |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCO)c1cccc(Nc2c(Cl)cc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2F3N2O3S/c16-12-6-9(15(18,19)20)7-13(17)14(12)22-10-2-1-3-11(8-10)26(24,25)21-4-5-23/h1-3,6-8,21-23H,4-5H2 |
| InChIKey | IZTDMRKDOWDBPT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide?
The IUPAC name of 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide (CID 42640876) is 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide.
What is the SMILES notation for 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide?
The canonical SMILES for 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide is O=S(=O)(NCCO)c1cccc(Nc2c(Cl)cc(C(F)(F)F)cc2Cl)c1.
What is the InChIKey of 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide?
The InChIKey is IZTDMRKDOWDBPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2F3N2O3S/c16-12-6-9(15(18,19)20)7-13(17)14(12)22-10-2-1-3-11(8-10)26(24,25)21-4-5-23/h1-3,6-8,21-23H,4-5H2.
What are the key properties of 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide?
3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide has a molecular weight of 429.25 g/mol, XLogP of 4.03, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-dichloro-4-(trifluoromethyl)anilino]-N-(2-hydroxyethyl)benzenesulfonamide is sourced from PubChem (CID 42640876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).