C24H26N6O — CID 42641401
N-(cyclohexylmethyl)-6-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]quinazolin-2-amine (PubChem CID 42641401) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-6-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]quinazolin-2-amine.
| Compound Name | N-(cyclohexylmethyl)-6-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]quinazolin-2-amine |
|---|---|
| PubChem CID | 42641401 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-(cyclohexylmethyl)-6-[[2-(1-methylpyrazol-4-yl)-4-pyridinyl]oxy]quinazolin-2-amine |
| SMILES | Cn1cc(-c2cc(Oc3ccc4nc(NCC5CCCCC5)ncc4c3)ccn2)cn1 |
| InChI | InChI=1S/C24H26N6O/c1-30-16-19(15-28-30)23-12-21(9-10-25-23)31-20-7-8-22-18(11-20)14-27-24(29-22)26-13-17-5-3-2-4-6-17/h7-12,14-17H,2-6,13H2,1H3,(H,26,27,29) |
| InChIKey | RCXWWGWFVLFOBB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |