C31H35F4N5O2 — CID 42641705
3-[4-[(2S)-4-methyl-2-(quinolin-6-ylmethylamino)pentan-2-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one (PubChem CID 42641705) has the molecular formula C31H35F4N5O2 and a molecular weight of 585.65 g/mol. Its IUPAC name is 3-[4-[(2S)-4-methyl-2-(quinolin-6-ylmethylamino)pentan-2-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one.
| Compound Name | 3-[4-[(2S)-4-methyl-2-(quinolin-6-ylmethylamino)pentan-2-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
|---|---|
| PubChem CID | 42641705 |
| Molecular Formula | C31H35F4N5O2 |
| Molecular Weight | 585.65 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | 3-[4-[(2S)-4-methyl-2-(quinolin-6-ylmethylamino)pentan-2-yl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
| SMILES | CCCCC(C(=O)COc1c(F)c(F)cc(F)c1F)n1cc([C@](C)(CC(C)C)NCc2ccc3ncccc3c2)nn1 |
| InChI | InChI=1S/C31H35F4N5O2/c1-5-6-9-25(26(41)18-42-30-28(34)22(32)14-23(33)29(30)35)40-17-27(38-39-40)31(4,15-19(2)3)37-16-20-10-11-24-21(13-20)8-7-12-36-24/h7-8,10-14,17,19,25,37H,5-6,9,15-16,18H2,1-4H3/t25?,31-/m0/s1 |
| InChIKey | KGNPAFUIDAMTOY-KHTLXAHUSA-N |
| XLogP | 6.81 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.65 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|