C31H33F4N5O2 — CID 42641817
3-[4-[(1S)-1-cyclobutyl-1-(quinolin-6-ylmethylamino)ethyl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one (PubChem CID 42641817) has the molecular formula C31H33F4N5O2 and a molecular weight of 583.63 g/mol. Its IUPAC name is 3-[4-[(1S)-1-cyclobutyl-1-(quinolin-6-ylmethylamino)ethyl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one.
| Compound Name | 3-[4-[(1S)-1-cyclobutyl-1-(quinolin-6-ylmethylamino)ethyl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
|---|---|
| PubChem CID | 42641817 |
| Molecular Formula | C31H33F4N5O2 |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 3-[4-[(1S)-1-cyclobutyl-1-(quinolin-6-ylmethylamino)ethyl]triazol-1-yl]-1-(2,3,5,6-tetrafluorophenoxy)heptan-2-one |
| SMILES | CCCCC(C(=O)COc1c(F)c(F)cc(F)c1F)n1cc([C@@](C)(NCc2ccc3ncccc3c2)C2CCC2)nn1 |
| InChI | InChI=1S/C31H33F4N5O2/c1-3-4-10-25(26(41)18-42-30-28(34)22(32)15-23(33)29(30)35)40-17-27(38-39-40)31(2,21-8-5-9-21)37-16-19-11-12-24-20(14-19)7-6-13-36-24/h6-7,11-15,17,21,25,37H,3-5,8-10,16,18H2,1-2H3/t25?,31-/m0/s1 |
| InChIKey | QNEYCAYMNPOGEH-KHTLXAHUSA-N |
| XLogP | 6.57 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|