C20H16F5N3O3 — CID 42642298
[(3R)-3-[(7-fluoro-1,3-benzoxazol-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 42642298) has the molecular formula C20H16F5N3O3 and a molecular weight of 441.36 g/mol. Its IUPAC name is [(3R)-3-[(7-fluoro-1,3-benzoxazol-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | [(3R)-3-[(7-fluoro-1,3-benzoxazol-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 42642298 |
| Molecular Formula | C20H16F5N3O3 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | [(3R)-3-[(7-fluoro-1,3-benzoxazol-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)(F)C(F)F)N1CC[C@@H](Nc2nc3cccc(F)c3o2)C1 |
| InChI | InChI=1S/C20H16F5N3O3/c21-13-5-3-6-14-16(13)30-19(27-14)26-11-8-9-28(10-11)17(29)12-4-1-2-7-15(12)31-20(24,25)18(22)23/h1-7,11,18H,8-10H2,(H,26,27)/t11-/m1/s1 |
| InChIKey | VAHBQGLRVAUVRF-LLVKDONJSA-N |
| XLogP | 4.53 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|