C20H15F6N3O3 — CID 42642300
[(3R)-3-[(6,7-difluoro-1,3-benzoxazol-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 42642300) has the molecular formula C20H15F6N3O3 and a molecular weight of 459.35 g/mol. Its IUPAC name is [(3R)-3-[(6,7-difluoro-1,3-benzoxazol-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | [(3R)-3-[(6,7-difluoro-1,3-benzoxazol-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 42642300 |
| Molecular Formula | C20H15F6N3O3 |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | [(3R)-3-[(6,7-difluoro-1,3-benzoxazol-2-yl)amino]pyrrolidin-1-yl]-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)(F)C(F)F)N1CC[C@@H](Nc2nc3ccc(F)c(F)c3o2)C1 |
| InChI | InChI=1S/C20H15F6N3O3/c21-12-5-6-13-16(15(12)22)31-19(28-13)27-10-7-8-29(9-10)17(30)11-3-1-2-4-14(11)32-20(25,26)18(23)24/h1-6,10,18H,7-9H2,(H,27,28)/t10-/m1/s1 |
| InChIKey | NWQCNBIERCQEHL-SNVBAGLBSA-N |
| XLogP | 4.67 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|