C30H44O4 — CID 42642427
(2S,4aS,5R,8aS)-5-[(E)-2-(4-carboxycyclohexyl)prop-1-enyl]-7-methyl-2-[(2R)-6-methylhept-5-en-2-yl]-2,5,8,8a-tetrahydro-1H-naphthalene-4a-carboxylic acid (PubChem CID 42642427) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is (2S,4aS,5R,8aS)-5-[(E)-2-(4-carboxycyclohexyl)prop-1-enyl]-7-methyl-2-[(2R)-6-methylhept-5-en-2-yl]-2,5,8,8a-tetrahydro-1H-naphthalene-4a-carboxylic acid.
| Compound Name | (2S,4aS,5R,8aS)-5-[(E)-2-(4-carboxycyclohexyl)prop-1-enyl]-7-methyl-2-[(2R)-6-methylhept-5-en-2-yl]-2,5,8,8a-tetrahydro-1H-naphthalene-4a-carboxylic acid |
|---|---|
| PubChem CID | 42642427 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (2S,4aS,5R,8aS)-5-[(E)-2-(4-carboxycyclohexyl)prop-1-enyl]-7-methyl-2-[(2R)-6-methylhept-5-en-2-yl]-2,5,8,8a-tetrahydro-1H-naphthalene-4a-carboxylic acid |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1C=C[C@@]2(C(=O)O)[C@H](CC(C)=C[C@@H]2/C=C(\C)C2CCC(C(=O)O)CC2)C1 |
| InChI | InChI=1S/C30H44O4/c1-19(2)7-6-8-21(4)25-13-14-30(29(33)34)26(15-20(3)16-27(30)18-25)17-22(5)23-9-11-24(12-10-23)28(31)32/h7,13-15,17,21,23-27H,6,8-12,16,18H2,1-5H3,(H,31,32)(H,33,34)/b22-17+/t21-,23?,24?,25+,26-,27-,30+/m1/s1 |
| InChIKey | OTBMTWUPWVANPM-PHEJYOGTSA-N |
| XLogP | 7.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|