C20H27F3N2O2S — CID 42642623
2-tert-butyl-5-(cyclopropylmethylsulfonyl)-1-(5,5,5-trifluoropentyl)benzimidazole (PubChem CID 42642623) has the molecular formula C20H27F3N2O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-tert-butyl-5-(cyclopropylmethylsulfonyl)-1-(5,5,5-trifluoropentyl)benzimidazole.
| Compound Name | 2-tert-butyl-5-(cyclopropylmethylsulfonyl)-1-(5,5,5-trifluoropentyl)benzimidazole |
|---|---|
| PubChem CID | 42642623 |
| Molecular Formula | C20H27F3N2O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-tert-butyl-5-(cyclopropylmethylsulfonyl)-1-(5,5,5-trifluoropentyl)benzimidazole |
| SMILES | CC(C)(C)c1nc2cc(S(=O)(=O)CC3CC3)ccc2n1CCCCC(F)(F)F |
| InChI | InChI=1S/C20H27F3N2O2S/c1-19(2,3)18-24-16-12-15(28(26,27)13-14-6-7-14)8-9-17(16)25(18)11-5-4-10-20(21,22)23/h8-9,12,14H,4-7,10-11,13H2,1-3H3 |
| InChIKey | CAMJSOQQSSCDOV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|