C21H19N5O4S — CID 42642727
4-[(4-nitrophenyl)methyl]-6-phenyl-2-(propylamino)-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione (PubChem CID 42642727) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 4-[(4-nitrophenyl)methyl]-6-phenyl-2-(propylamino)-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione.
| Compound Name | 4-[(4-nitrophenyl)methyl]-6-phenyl-2-(propylamino)-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 42642727 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 4-[(4-nitrophenyl)methyl]-6-phenyl-2-(propylamino)-[1,3]thiazolo[4,5-d]pyrimidine-5,7-dione |
| SMILES | CCCNc1nc2c(s1)c(=O)n(-c1ccccc1)c(=O)n2Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19N5O4S/c1-2-12-22-20-23-18-17(31-20)19(27)25(15-6-4-3-5-7-15)21(28)24(18)13-14-8-10-16(11-9-14)26(29)30/h3-11H,2,12-13H2,1H3,(H,22,23) |
| InChIKey | CXOKZSCNPBZLQB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|