C25H21NO4 — CID 42642778
9,9-dimethyl-12-(4-nitrophenyl)-10,12-dihydro-8H-benzo[a]xanthen-11-one (PubChem CID 42642778) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 9,9-dimethyl-12-(4-nitrophenyl)-10,12-dihydro-8H-benzo[a]xanthen-11-one.
| Compound Name | 9,9-dimethyl-12-(4-nitrophenyl)-10,12-dihydro-8H-benzo[a]xanthen-11-one |
|---|---|
| PubChem CID | 42642778 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 9,9-dimethyl-12-(4-nitrophenyl)-10,12-dihydro-8H-benzo[a]xanthen-11-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1ccc3ccccc3c1C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H21NO4/c1-25(2)13-19(27)24-21(14-25)30-20-12-9-15-5-3-4-6-18(15)23(20)22(24)16-7-10-17(11-8-16)26(28)29/h3-12,22H,13-14H2,1-2H3 |
| InChIKey | AFAUJOVZUDGAKM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|