C14H18O6 — CID 42643178
(3E,6S,9E,11S,14S)-11-hydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8-trione (PubChem CID 42643178) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is (3E,6S,9E,11S,14S)-11-hydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8-trione.
| Compound Name | (3E,6S,9E,11S,14S)-11-hydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8-trione |
|---|---|
| PubChem CID | 42643178 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (3E,6S,9E,11S,14S)-11-hydroxy-6,14-dimethyl-1,7-dioxacyclotetradeca-3,9-diene-2,5,8-trione |
| SMILES | C[C@@H]1OC(=O)/C=C/[C@@H](O)CC[C@H](C)OC(=O)/C=C/C1=O |
| InChI | InChI=1S/C14H18O6/c1-9-3-4-11(15)5-7-14(18)20-10(2)12(16)6-8-13(17)19-9/h5-11,15H,3-4H2,1-2H3/b7-5+,8-6+/t9-,10-,11-/m0/s1 |
| InChIKey | GEKLGAVADGRICH-BTRGTPCNSA-N |
| XLogP | 0.69 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |