About (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine
(Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine (PubChem CID 42643240) has the molecular formula C12H11ClN2O
and a molecular weight of 234.69 g/mol. Its IUPAC name is (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine.
Molecular Properties
| Compound Name | (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine |
| PubChem CID | 42643240 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine |
| SMILES | Cc1cc(/C=C(\N)c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C12H11ClN2O/c1-8-6-11(16-15-8)7-12(14)9-2-4-10(13)5-3-9/h2-7H,14H2,1H3/b12-7- |
| InChIKey | GHBGVRIYAJRAGL-GHXNOFRVSA-N |
| XLogP | 3.09 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine?
The IUPAC name of (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine (CID 42643240) is (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine.
What is the SMILES notation for (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine?
The canonical SMILES for (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine is Cc1cc(/C=C(\N)c2ccc(Cl)cc2)on1.
What is the InChIKey of (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine?
The InChIKey is GHBGVRIYAJRAGL-GHXNOFRVSA-N. The full InChI is InChI=1S/C12H11ClN2O/c1-8-6-11(16-15-8)7-12(14)9-2-4-10(13)5-3-9/h2-7H,14H2,1H3/b12-7-.
What are the key properties of (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine?
(Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine has a molecular weight of 234.69 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(4-chlorophenyl)-2-(3-methyl-1,2-oxazol-5-yl)ethenamine is sourced from PubChem (CID 42643240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).