C12H20O11S3 — CID 42643351
ethyl (3R,4S,5R)-3,4,5-tris(methylsulfonyloxy)cyclohexene-1-carboxylate (PubChem CID 42643351) has the molecular formula C12H20O11S3 and a molecular weight of 436.48 g/mol. Its IUPAC name is ethyl (3R,4S,5R)-3,4,5-tris(methylsulfonyloxy)cyclohexene-1-carboxylate.
| Compound Name | ethyl (3R,4S,5R)-3,4,5-tris(methylsulfonyloxy)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 42643351 |
| Molecular Formula | C12H20O11S3 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | ethyl (3R,4S,5R)-3,4,5-tris(methylsulfonyloxy)cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OS(C)(=O)=O)[C@@H](OS(C)(=O)=O)[C@H](OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H20O11S3/c1-5-20-12(13)8-6-9(21-24(2,14)15)11(23-26(4,18)19)10(7-8)22-25(3,16)17/h6,9-11H,5,7H2,1-4H3/t9-,10-,11-/m1/s1 |
| InChIKey | FFTIPZOFMCTWMF-GMTAPVOTSA-N |
| XLogP | -1.09 |
| TPSA | 156.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|