About (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol
(2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol (PubChem CID 42643392) has the molecular formula C13H26O2Si
and a molecular weight of 242.43 g/mol. Its IUPAC name is (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol.
Molecular Properties
| Compound Name | (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol |
| PubChem CID | 42643392 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@@H](C)O |
| InChI | InChI=1S/C13H26O2Si/c1-10(9-11(2)14)12(3)15-16(7,8)13(4,5)6/h9,11,14H,3H2,1-2,4-8H3/b10-9+/t11-/m1/s1 |
| InChIKey | IQXOMZWMJTYGKL-PBQZMEPESA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol?
The IUPAC name of (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol (CID 42643392) is (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol.
What is the SMILES notation for (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol?
The canonical SMILES for (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol is C=C(O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@@H](C)O.
What is the InChIKey of (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol?
The InChIKey is IQXOMZWMJTYGKL-PBQZMEPESA-N. The full InChI is InChI=1S/C13H26O2Si/c1-10(9-11(2)14)12(3)15-16(7,8)13(4,5)6/h9,11,14H,3H2,1-2,4-8H3/b10-9+/t11-/m1/s1.
What are the key properties of (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol?
(2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol has a molecular weight of 242.43 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3E)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhexa-3,5-dien-2-ol is sourced from PubChem (CID 42643392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).