C12H13BrO2 — CID 42643497
(4aR,10aS)-8-bromo-2,3,4,4a,5,10a-hexahydropyrano[2,3-b]chromene (PubChem CID 42643497) has the molecular formula C12H13BrO2 and a molecular weight of 269.14 g/mol. Its IUPAC name is (4aR,10aS)-8-bromo-2,3,4,4a,5,10a-hexahydropyrano[2,3-b]chromene.
| Compound Name | (4aR,10aS)-8-bromo-2,3,4,4a,5,10a-hexahydropyrano[2,3-b]chromene |
|---|---|
| PubChem CID | 42643497 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | (4aR,10aS)-8-bromo-2,3,4,4a,5,10a-hexahydropyrano[2,3-b]chromene |
| SMILES | Brc1ccc2c(c1)O[C@@H]1OCCC[C@@H]1C2 |
| InChI | InChI=1S/C12H13BrO2/c13-10-4-3-8-6-9-2-1-5-14-12(9)15-11(8)7-10/h3-4,7,9,12H,1-2,5-6H2/t9-,12+/m1/s1 |
| InChIKey | QYXXPFKHTQJLKB-SKDRFNHKSA-N |
| XLogP | 3.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |