About ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate
ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate (PubChem CID 42643703) has the molecular formula C19H18FNO2S
and a molecular weight of 343.42 g/mol. Its IUPAC name is ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate |
| PubChem CID | 42643703 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2ccccc2SC1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FNO2S/c1-3-23-19(22)17-12(2)21-15-6-4-5-7-16(15)24-18(17)13-8-10-14(20)11-9-13/h4-11,18,21H,3H2,1-2H3 |
| InChIKey | DTIHFHAVWZYOGH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate?
The IUPAC name of ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate (CID 42643703) is ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate.
What is the SMILES notation for ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate?
The canonical SMILES for ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate is CCOC(=O)C1=C(C)Nc2ccccc2SC1c1ccc(F)cc1.
What is the InChIKey of ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate?
The InChIKey is DTIHFHAVWZYOGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FNO2S/c1-3-23-19(22)17-12(2)21-15-6-4-5-7-16(15)24-18(17)13-8-10-14(20)11-9-13/h4-11,18,21H,3H2,1-2H3.
What are the key properties of ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate?
ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate has a molecular weight of 343.42 g/mol, XLogP of 4.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-fluorophenyl)-4-methyl-2,5-dihydro-1,5-benzothiazepine-3-carboxylate is sourced from PubChem (CID 42643703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).