C30H28ClFN6O4S — CID 42643918
2-(dimethylamino)ethyl 1-[(2-chloro-1,8-naphthyridin-3-yl)methyl]-3-(2,2-dioxo-1,4-dihydro-2λ6,1,3-benzothiadiazin-3-yl)-6-fluoro-5-methylindole-2-carboxylate (PubChem CID 42643918) has the molecular formula C30H28ClFN6O4S and a molecular weight of 623.11 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 1-[(2-chloro-1,8-naphthyridin-3-yl)methyl]-3-(2,2-dioxo-1,4-dihydro-2λ6,1,3-benzothiadiazin-3-yl)-6-fluoro-5-methylindole-2-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl 1-[(2-chloro-1,8-naphthyridin-3-yl)methyl]-3-(2,2-dioxo-1,4-dihydro-2λ6,1,3-benzothiadiazin-3-yl)-6-fluoro-5-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 42643918 |
| Molecular Formula | C30H28ClFN6O4S |
| Molecular Weight | 623.11 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | 2-(dimethylamino)ethyl 1-[(2-chloro-1,8-naphthyridin-3-yl)methyl]-3-(2,2-dioxo-1,4-dihydro-2λ6,1,3-benzothiadiazin-3-yl)-6-fluoro-5-methylindole-2-carboxylate |
| SMILES | Cc1cc2c(N3Cc4ccccc4NS3(=O)=O)c(C(=O)OCCN(C)C)n(Cc3cc4cccnc4nc3Cl)c2cc1F |
| InChI | InChI=1S/C30H28ClFN6O4S/c1-18-13-22-25(15-23(18)32)37(16-21-14-19-8-6-10-33-29(19)34-28(21)31)27(30(39)42-12-11-36(2)3)26(22)38-17-20-7-4-5-9-24(20)35-43(38,40)41/h4-10,13-15,35H,11-12,16-17H2,1-3H3 |
| InChIKey | NZSBKDFYJQUOPR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.11 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|