About (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate
(Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate (PubChem CID 42644010) has the molecular formula C20H14N4O2
and a molecular weight of 342.36 g/mol. Its IUPAC name is (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate.
Molecular Properties
| Compound Name | (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate |
| PubChem CID | 42644010 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate |
| SMILES | [O-]/C(=N\[n+]1ccc(-c2nnc(-c3ccccc3)o2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H14N4O2/c25-18(15-7-3-1-4-8-15)23-24-13-11-17(12-14-24)20-22-21-19(26-20)16-9-5-2-6-10-16/h1-14H |
| InChIKey | MGRPZMYVKFFTDT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate?
The IUPAC name of (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate (CID 42644010) is (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate.
What is the SMILES notation for (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate?
The canonical SMILES for (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate is [O-]/C(=N\[n+]1ccc(-c2nnc(-c3ccccc3)o2)cc1)c1ccccc1.
What is the InChIKey of (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate?
The InChIKey is MGRPZMYVKFFTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O2/c25-18(15-7-3-1-4-8-15)23-24-13-11-17(12-14-24)20-22-21-19(26-20)16-9-5-2-6-10-16/h1-14H.
What are the key properties of (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate?
(Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate has a molecular weight of 342.36 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridin-1-ium-1-yl]benzenecarboximidate is sourced from PubChem (CID 42644010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).