About 3-(trifluoromethyl)-3,4-dihydrochromen-2-one
3-(trifluoromethyl)-3,4-dihydrochromen-2-one (PubChem CID 42644042) has the molecular formula C10H7F3O2
and a molecular weight of 216.16 g/mol. Its IUPAC name is 3-(trifluoromethyl)-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-3,4-dihydrochromen-2-one |
| PubChem CID | 42644042 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 3-(trifluoromethyl)-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2ccccc2CC1C(F)(F)F |
| InChI | InChI=1S/C10H7F3O2/c11-10(12,13)7-5-6-3-1-2-4-8(6)15-9(7)14/h1-4,7H,5H2 |
| InChIKey | UQRJSFCIBNFAMM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-(trifluoromethyl)-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-3,4-dihydrochromen-2-one?
The IUPAC name of 3-(trifluoromethyl)-3,4-dihydrochromen-2-one (CID 42644042) is 3-(trifluoromethyl)-3,4-dihydrochromen-2-one.
What is the SMILES notation for 3-(trifluoromethyl)-3,4-dihydrochromen-2-one?
The canonical SMILES for 3-(trifluoromethyl)-3,4-dihydrochromen-2-one is O=C1Oc2ccccc2CC1C(F)(F)F.
What is the InChIKey of 3-(trifluoromethyl)-3,4-dihydrochromen-2-one?
The InChIKey is UQRJSFCIBNFAMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3O2/c11-10(12,13)7-5-6-3-1-2-4-8(6)15-9(7)14/h1-4,7H,5H2.
What are the key properties of 3-(trifluoromethyl)-3,4-dihydrochromen-2-one?
3-(trifluoromethyl)-3,4-dihydrochromen-2-one has a molecular weight of 216.16 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-3,4-dihydrochromen-2-one is sourced from PubChem (CID 42644042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).