C37H49NO2 — CID 42644188
(1R,2R,15R,18R,19S,22S,27S)-2,14,14,18,19,25,25-heptamethyl-12-azaheptacyclo[16.12.0.02,15.04,13.06,11.019,28.022,27]triaconta-4,6,8,10,12,28-hexaene-22-carboxylic acid (PubChem CID 42644188) has the molecular formula C37H49NO2 and a molecular weight of 539.80 g/mol. Its IUPAC name is (1R,2R,15R,18R,19S,22S,27S)-2,14,14,18,19,25,25-heptamethyl-12-azaheptacyclo[16.12.0.02,15.04,13.06,11.019,28.022,27]triaconta-4,6,8,10,12,28-hexaene-22-carboxylic acid.
| Compound Name | (1R,2R,15R,18R,19S,22S,27S)-2,14,14,18,19,25,25-heptamethyl-12-azaheptacyclo[16.12.0.02,15.04,13.06,11.019,28.022,27]triaconta-4,6,8,10,12,28-hexaene-22-carboxylic acid |
|---|---|
| PubChem CID | 42644188 |
| Molecular Formula | C37H49NO2 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.38 |
| IUPAC Name | (1R,2R,15R,18R,19S,22S,27S)-2,14,14,18,19,25,25-heptamethyl-12-azaheptacyclo[16.12.0.02,15.04,13.06,11.019,28.022,27]triaconta-4,6,8,10,12,28-hexaene-22-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6cc7ccccc7nc6C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C37H49NO2/c1-32(2)16-18-37(31(39)40)19-17-35(6)25(26(37)22-32)12-13-29-34(5)21-24-20-23-10-8-9-11-27(23)38-30(24)33(3,4)28(34)14-15-36(29,35)7/h8-12,20,26,28-29H,13-19,21-22H2,1-7H3,(H,39,40)/t26-,28-,29+,34-,35+,36+,37-/m0/s1 |
| InChIKey | RKUOZQPYOYQPON-JKSHRDJASA-N |
| XLogP | 9.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|