About 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one
5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one (PubChem CID 42644211) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one |
| PubChem CID | 42644211 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one |
| SMILES | CCC#CCc1c(C)[nH][nH]c1=O |
| InChI | InChI=1S/C9H12N2O/c1-3-4-5-6-8-7(2)10-11-9(8)12/h3,6H2,1-2H3,(H2,10,11,12) |
| InChIKey | ZPQBKLYDAKWERY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one (CID 42644211) is 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one is CCC#CCc1c(C)[nH][nH]c1=O.
What is the InChIKey of 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one?
The InChIKey is ZPQBKLYDAKWERY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-3-4-5-6-8-7(2)10-11-9(8)12/h3,6H2,1-2H3,(H2,10,11,12).
What are the key properties of 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one?
5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one has a molecular weight of 164.21 g/mol, XLogP of 0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-pent-2-ynyl-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 42644211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).