C37H59NO4 — CID 42644661
methyl (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]-4-methylpentanoate (PubChem CID 42644661) has the molecular formula C37H59NO4 and a molecular weight of 581.88 g/mol. Its IUPAC name is methyl (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 42644661 |
| Molecular Formula | C37H59NO4 |
| Molecular Weight | 581.88 g/mol |
| Exact Mass | 581.44 |
| IUPAC Name | methyl (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NC(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C37H59NO4/c1-23(2)21-26(30(40)42-10)38-31(41)37-19-17-32(3,4)22-25(37)24-11-12-28-34(7)15-14-29(39)33(5,6)27(34)13-16-36(28,9)35(24,8)18-20-37/h11,23,25-28H,12-22H2,1-10H3,(H,38,41)/t25-,26-,27-,28+,34-,35+,36+,37-/m0/s1 |
| InChIKey | MZMOGRVYTSSPEP-ORBNRKNMSA-N |
| XLogP | 8.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.88 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|