About (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide
(E)-3-(dimethylamino)-N,2-diformylprop-2-enamide (PubChem CID 42644716) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide |
| PubChem CID | 42644716 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide |
| SMILES | CN(C)/C=C(\C=O)C(=O)NC=O |
| InChI | InChI=1S/C7H10N2O3/c1-9(2)3-6(4-10)7(12)8-5-11/h3-5H,1-2H3,(H,8,11,12)/b6-3+ |
| InChIKey | JKPMVRAEOJPKEZ-ZZXKWVIFSA-N |
| XLogP | -1.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide?
The IUPAC name of (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide (CID 42644716) is (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide.
What is the SMILES notation for (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide?
The canonical SMILES for (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide is CN(C)/C=C(\C=O)C(=O)NC=O.
What is the InChIKey of (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide?
The InChIKey is JKPMVRAEOJPKEZ-ZZXKWVIFSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-9(2)3-6(4-10)7(12)8-5-11/h3-5H,1-2H3,(H,8,11,12)/b6-3+.
What are the key properties of (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide?
(E)-3-(dimethylamino)-N,2-diformylprop-2-enamide has a molecular weight of 170.17 g/mol, XLogP of -1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(dimethylamino)-N,2-diformylprop-2-enamide is sourced from PubChem (CID 42644716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).