C34H53NO4 — CID 42644898
methyl (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]propanoate (PubChem CID 42644898) has the molecular formula C34H53NO4 and a molecular weight of 539.80 g/mol. Its IUPAC name is methyl (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 42644898 |
| Molecular Formula | C34H53NO4 |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.40 |
| IUPAC Name | methyl (2S)-2-[[(4aS,6aR,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picene-4a-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C34H53NO4/c1-21(27(37)39-9)35-28(38)34-18-16-29(2,3)20-23(34)22-10-11-25-31(6)14-13-26(36)30(4,5)24(31)12-15-33(25,8)32(22,7)17-19-34/h10,21,23-25H,11-20H2,1-9H3,(H,35,38)/t21-,23-,24-,25+,31-,32+,33+,34-/m0/s1 |
| InChIKey | NQLDWCYEHGGYBN-PZSTVSEXSA-N |
| XLogP | 7.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|