C5H6N6 — CID 4264519
[1,2,4]triazolo[4,3-b]pyridazin-6-ylhydrazine (PubChem CID 4264519) has the molecular formula C5H6N6 and a molecular weight of 150.15 g/mol. Its IUPAC name is [1,2,4]triazolo[4,3-b]pyridazin-6-ylhydrazine.
| Compound Name | [1,2,4]triazolo[4,3-b]pyridazin-6-ylhydrazine |
|---|---|
| PubChem CID | 4264519 |
| Molecular Formula | C5H6N6 |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | [1,2,4]triazolo[4,3-b]pyridazin-6-ylhydrazine |
| SMILES | NNc1ccc2nncn2n1 |
| InChI | InChI=1S/C5H6N6/c6-8-4-1-2-5-9-7-3-11(5)10-4/h1-3H,6H2,(H,8,10) |
| InChIKey | KHYHMEVBVZNXLZ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|