C17H18ClN2O7P — CID 42645199
1-chloro-5-[diethoxyphosphoryl(phenyl)methyl]-2,4-dinitrobenzene (PubChem CID 42645199) has the molecular formula C17H18ClN2O7P and a molecular weight of 428.77 g/mol. Its IUPAC name is 1-chloro-5-[diethoxyphosphoryl(phenyl)methyl]-2,4-dinitrobenzene.
| Compound Name | 1-chloro-5-[diethoxyphosphoryl(phenyl)methyl]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 42645199 |
| Molecular Formula | C17H18ClN2O7P |
| Molecular Weight | 428.77 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-chloro-5-[diethoxyphosphoryl(phenyl)methyl]-2,4-dinitrobenzene |
| SMILES | CCOP(=O)(OCC)C(c1ccccc1)c1cc(Cl)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18ClN2O7P/c1-3-26-28(25,27-4-2)17(12-8-6-5-7-9-12)13-10-14(18)16(20(23)24)11-15(13)19(21)22/h5-11,17H,3-4H2,1-2H3 |
| InChIKey | GDBBJNUFDWATNF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|