C19H25N3O — CID 42645282
2-amino-N-[(2R)-2-amino-3-phenylpropyl]-3-propylbenzamide (PubChem CID 42645282) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-amino-N-[(2R)-2-amino-3-phenylpropyl]-3-propylbenzamide.
| Compound Name | 2-amino-N-[(2R)-2-amino-3-phenylpropyl]-3-propylbenzamide |
|---|---|
| PubChem CID | 42645282 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 2-amino-N-[(2R)-2-amino-3-phenylpropyl]-3-propylbenzamide |
| SMILES | CCCc1cccc(C(=O)NC[C@H](N)Cc2ccccc2)c1N |
| InChI | InChI=1S/C19H25N3O/c1-2-7-15-10-6-11-17(18(15)21)19(23)22-13-16(20)12-14-8-4-3-5-9-14/h3-6,8-11,16H,2,7,12-13,20-21H2,1H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | OXMWYBGRAJUOKC-MRXNPFEDSA-N |
| XLogP | 2.52 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|