C23H20N4O2S — CID 42645486
6-(benzenesulfonyl)-N-quinolin-3-yl-7,8-dihydro-5H-2,6-naphthyridin-1-amine (PubChem CID 42645486) has the molecular formula C23H20N4O2S and a molecular weight of 416.51 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-N-quinolin-3-yl-7,8-dihydro-5H-2,6-naphthyridin-1-amine.
| Compound Name | 6-(benzenesulfonyl)-N-quinolin-3-yl-7,8-dihydro-5H-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 42645486 |
| Molecular Formula | C23H20N4O2S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 6-(benzenesulfonyl)-N-quinolin-3-yl-7,8-dihydro-5H-2,6-naphthyridin-1-amine |
| SMILES | O=S(=O)(c1ccccc1)N1CCc2c(ccnc2Nc2cnc3ccccc3c2)C1 |
| InChI | InChI=1S/C23H20N4O2S/c28-30(29,20-7-2-1-3-8-20)27-13-11-21-18(16-27)10-12-24-23(21)26-19-14-17-6-4-5-9-22(17)25-15-19/h1-10,12,14-15H,11,13,16H2,(H,24,26) |
| InChIKey | GMBPLHUXLWINQM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |