C20H39NO2 — CID 42645676
(2S,3R,4E)-2-(hydroxymethyl)-4-tetradecylidenepiperidin-3-ol (PubChem CID 42645676) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is (2S,3R,4E)-2-(hydroxymethyl)-4-tetradecylidenepiperidin-3-ol.
| Compound Name | (2S,3R,4E)-2-(hydroxymethyl)-4-tetradecylidenepiperidin-3-ol |
|---|---|
| PubChem CID | 42645676 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | (2S,3R,4E)-2-(hydroxymethyl)-4-tetradecylidenepiperidin-3-ol |
| SMILES | CCCCCCCCCCCCC/C=C1\CCN[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C20H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-18-15-16-21-19(17-22)20(18)23/h14,19-23H,2-13,15-17H2,1H3/b18-14+/t19-,20+/m0/s1 |
| InChIKey | NLXJKJWXAMSOJJ-GSVFGGHHSA-N |
| XLogP | 4.33 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|