About [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea
[[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea (PubChem CID 4264598) has the molecular formula C2H8N6O3
and a molecular weight of 164.12 g/mol. Its IUPAC name is [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea.
Molecular Properties
| Compound Name | [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea |
| PubChem CID | 4264598 |
| Molecular Formula | C2H8N6O3 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea |
| SMILES | NC(=O)NN=C(N)NN(O)O |
| InChI | InChI=1S/C2H8N6O3/c3-1(7-8(10)11)5-6-2(4)9/h10-11H,(H3,3,5,7)(H3,4,6,9) |
| InChIKey | SGXJOFUYOWTRAY-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea?
The IUPAC name of [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea (CID 4264598) is [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea.
What is the SMILES notation for [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea?
The canonical SMILES for [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea is NC(=O)NN=C(N)NN(O)O.
What is the InChIKey of [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea?
The InChIKey is SGXJOFUYOWTRAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8N6O3/c3-1(7-8(10)11)5-6-2(4)9/h10-11H,(H3,3,5,7)(H3,4,6,9).
What are the key properties of [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea?
[[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea has a molecular weight of 164.12 g/mol, XLogP of -2.53, 2 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(2,2-dihydroxyhydrazinyl)methylidene]amino]urea is sourced from PubChem (CID 4264598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).