C26H33N3O3S — CID 42646116
(1R,2S,6R,7R,10R)-4-[2-(4-methoxyphenyl)imino-1,3-thiazepan-3-yl]-8-methyl-10-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 42646116) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is (1R,2S,6R,7R,10R)-4-[2-(4-methoxyphenyl)imino-1,3-thiazepan-3-yl]-8-methyl-10-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R,10R)-4-[2-(4-methoxyphenyl)imino-1,3-thiazepan-3-yl]-8-methyl-10-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 42646116 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (1R,2S,6R,7R,10R)-4-[2-(4-methoxyphenyl)imino-1,3-thiazepan-3-yl]-8-methyl-10-propan-2-yl-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | COc1ccc(/N=C2\SCCCCN2N2C(=O)[C@H]3[C@H]4C=C(C)[C@H](C[C@@H]4C(C)C)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C26H33N3O3S/c1-15(2)19-14-20-16(3)13-21(19)23-22(20)24(30)29(25(23)31)28-11-5-6-12-33-26(28)27-17-7-9-18(32-4)10-8-17/h7-10,13,15,19-23H,5-6,11-12,14H2,1-4H3/b27-26-/t19-,20+,21+,22-,23+/m1/s1 |
| InChIKey | CUULOCBDXQVPJR-ZLOVTZBUSA-N |
| XLogP | 4.90 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|