About 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine
4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 42646215) has the molecular formula C12H8F3N5S
and a molecular weight of 311.29 g/mol. Its IUPAC name is 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine |
| PubChem CID | 42646215 |
| Molecular Formula | C12H8F3N5S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | C1=CC=NC(=C1)NC2=NC(=C(S2)C(F)(F)F)C3=CNN=C3 |
| InChI | InChI=1S/C12H8F3N5S/c13-12(14,15)10-9(7-5-17-18-6-7)20-11(21-10)19-8-3-1-2-4-16-8/h1-6H,(H,17,18)(H,16,19,20) |
| InChIKey | SSWUDUWSVKZLIJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | 356 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine (CID 42646215) is 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine is C1=CC=NC(=C1)NC2=NC(=C(S2)C(F)(F)F)C3=CNN=C3.
What is the InChIKey of 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine?
The InChIKey is SSWUDUWSVKZLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3N5S/c13-12(14,15)10-9(7-5-17-18-6-7)20-11(21-10)19-8-3-1-2-4-16-8/h1-6H,(H,17,18)(H,16,19,20).
What are the key properties of 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine?
4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine has a molecular weight of 311.29 g/mol, XLogP of 3.00, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-pyrazol-4-yl)-N-pyridin-2-yl-5-(trifluoromethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 42646215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).