C20H15BN2O4 — CID 42646419
2-[4-(1,3,2-dioxaborinan-2-yl)phenyl]-1H-benzo[f]benzimidazole-4,9-dione (PubChem CID 42646419) has the molecular formula C20H15BN2O4 and a molecular weight of 358.16 g/mol. Its IUPAC name is 2-[4-(1,3,2-dioxaborinan-2-yl)phenyl]-1H-benzo[f]benzimidazole-4,9-dione.
| Compound Name | 2-[4-(1,3,2-dioxaborinan-2-yl)phenyl]-1H-benzo[f]benzimidazole-4,9-dione |
|---|---|
| PubChem CID | 42646419 |
| Molecular Formula | C20H15BN2O4 |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-[4-(1,3,2-dioxaborinan-2-yl)phenyl]-1H-benzo[f]benzimidazole-4,9-dione |
| SMILES | O=C1c2ccccc2C(=O)c2[nH]c(-c3ccc(B4OCCCO4)cc3)nc21 |
| InChI | InChI=1S/C20H15BN2O4/c24-18-14-4-1-2-5-15(14)19(25)17-16(18)22-20(23-17)12-6-8-13(9-7-12)21-26-10-3-11-27-21/h1-2,4-9H,3,10-11H2,(H,22,23) |
| InChIKey | IOJSEHCTUCCURS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|