C23H37NO4 — CID 42646585
methyl 3,5-ditert-butyl-4-(hexylcarbamoyloxy)benzoate (PubChem CID 42646585) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is methyl 3,5-ditert-butyl-4-(hexylcarbamoyloxy)benzoate.
| Compound Name | methyl 3,5-ditert-butyl-4-(hexylcarbamoyloxy)benzoate |
|---|---|
| PubChem CID | 42646585 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | methyl 3,5-ditert-butyl-4-(hexylcarbamoyloxy)benzoate |
| SMILES | CCCCCCNC(=O)Oc1c(C(C)(C)C)cc(C(=O)OC)cc1C(C)(C)C |
| InChI | InChI=1S/C23H37NO4/c1-9-10-11-12-13-24-21(26)28-19-17(22(2,3)4)14-16(20(25)27-8)15-18(19)23(5,6)7/h14-15H,9-13H2,1-8H3,(H,24,26) |
| InChIKey | JFUBEKTUXHOWRY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|