C24H44O5Si — CID 42646671
ethyl (E)-9,9-dimethyl-5,10-dioxo-11-tri(propan-2-yl)silyloxyundec-2-enoate (PubChem CID 42646671) has the molecular formula C24H44O5Si and a molecular weight of 440.70 g/mol. Its IUPAC name is ethyl (E)-9,9-dimethyl-5,10-dioxo-11-tri(propan-2-yl)silyloxyundec-2-enoate.
| Compound Name | ethyl (E)-9,9-dimethyl-5,10-dioxo-11-tri(propan-2-yl)silyloxyundec-2-enoate |
|---|---|
| PubChem CID | 42646671 |
| Molecular Formula | C24H44O5Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | ethyl (E)-9,9-dimethyl-5,10-dioxo-11-tri(propan-2-yl)silyloxyundec-2-enoate |
| SMILES | CCOC(=O)/C=C/CC(=O)CCCC(C)(C)C(=O)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H44O5Si/c1-10-28-23(27)15-11-13-21(25)14-12-16-24(8,9)22(26)17-29-30(18(2)3,19(4)5)20(6)7/h11,15,18-20H,10,12-14,16-17H2,1-9H3/b15-11+ |
| InChIKey | SMCDGDILRFVDMN-RVDMUPIBSA-N |
| XLogP | 6.02 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|