C14H13ClN2O4S2 — CID 42646765
2-[[(E)-2-(2-chlorophenyl)ethenyl]sulfonylamino]benzenesulfonamide (PubChem CID 42646765) has the molecular formula C14H13ClN2O4S2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 2-[[(E)-2-(2-chlorophenyl)ethenyl]sulfonylamino]benzenesulfonamide.
| Compound Name | 2-[[(E)-2-(2-chlorophenyl)ethenyl]sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 42646765 |
| Molecular Formula | C14H13ClN2O4S2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 2-[[(E)-2-(2-chlorophenyl)ethenyl]sulfonylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1NS(=O)(=O)/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C14H13ClN2O4S2/c15-12-6-2-1-5-11(12)9-10-22(18,19)17-13-7-3-4-8-14(13)23(16,20)21/h1-10,17H,(H2,16,20,21)/b10-9+ |
| InChIKey | PZVACPHKBWKVIP-MDZDMXLPSA-N |
| XLogP | 2.40 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |