About 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone
2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone (PubChem CID 4264695) has the molecular formula C11H12ClNO
and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone.
Molecular Properties
| Compound Name | 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
| PubChem CID | 4264695 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
| SMILES | O=C(CCl)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C11H12ClNO/c12-7-11(14)13-6-5-9-3-1-2-4-10(9)8-13/h1-4H,5-8H2 |
| InChIKey | XJOLYGFCZOFURL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone?
The IUPAC name of 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone (CID 4264695) is 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone.
What is the SMILES notation for 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone?
The canonical SMILES for 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone is O=C(CCl)N1CCc2ccccc2C1.
What is the InChIKey of 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone?
The InChIKey is XJOLYGFCZOFURL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO/c12-7-11(14)13-6-5-9-3-1-2-4-10(9)8-13/h1-4H,5-8H2.
What are the key properties of 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone?
2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone has a molecular weight of 209.68 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone is sourced from PubChem (CID 4264695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).