C22H33N5 — CID 42647009
N-[3-(7,9a-dimethyl-7-phenyl-2,3,4,6,8,9-hexahydro-1H-quinolizin-2-yl)propyl]-1H-1,2,4-triazol-5-amine (PubChem CID 42647009) has the molecular formula C22H33N5 and a molecular weight of 367.54 g/mol. Its IUPAC name is N-[3-(7,9a-dimethyl-7-phenyl-2,3,4,6,8,9-hexahydro-1H-quinolizin-2-yl)propyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | N-[3-(7,9a-dimethyl-7-phenyl-2,3,4,6,8,9-hexahydro-1H-quinolizin-2-yl)propyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 42647009 |
| Molecular Formula | C22H33N5 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | N-[3-(7,9a-dimethyl-7-phenyl-2,3,4,6,8,9-hexahydro-1H-quinolizin-2-yl)propyl]-1H-1,2,4-triazol-5-amine |
| SMILES | CC1(c2ccccc2)CCC2(C)CC(CCCNc3ncn[nH]3)CCN2C1 |
| InChI | InChI=1S/C22H33N5/c1-21(19-8-4-3-5-9-19)11-12-22(2)15-18(10-14-27(22)16-21)7-6-13-23-20-24-17-25-26-20/h3-5,8-9,17-18H,6-7,10-16H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | UQKWRCZHGVZPLQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|