About N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide
N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide (PubChem CID 42647178) has the molecular formula C20H22Cl2N2O
and a molecular weight of 377.32 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide |
| PubChem CID | 42647178 |
| Molecular Formula | C20H22Cl2N2O |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide |
| SMILES | CC1(c2ccccc2)CCCN(C(=O)NCc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C20H22Cl2N2O/c1-20(16-6-3-2-4-7-16)10-5-11-24(14-20)19(25)23-13-15-8-9-17(21)12-18(15)22/h2-4,6-9,12H,5,10-11,13-14H2,1H3,(H,23,25) |
| InChIKey | MBEXSEUYYAPDIQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide?
The IUPAC name of N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide (CID 42647178) is N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide.
What is the SMILES notation for N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide?
The canonical SMILES for N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide is CC1(c2ccccc2)CCCN(C(=O)NCc2ccc(Cl)cc2Cl)C1.
What is the InChIKey of N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide?
The InChIKey is MBEXSEUYYAPDIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2N2O/c1-20(16-6-3-2-4-7-16)10-5-11-24(14-20)19(25)23-13-15-8-9-17(21)12-18(15)22/h2-4,6-9,12H,5,10-11,13-14H2,1H3,(H,23,25).
What are the key properties of N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide?
N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide has a molecular weight of 377.32 g/mol, XLogP of 5.26, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dichlorophenyl)methyl]-3-methyl-3-phenylpiperidine-1-carboxamide is sourced from PubChem (CID 42647178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).