About (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine
(4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine (PubChem CID 42647358) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine.
Molecular Properties
| Compound Name | (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine |
| PubChem CID | 42647358 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine |
| SMILES | COc1cc(CN)c(OC)c2c1OCO2 |
| InChI | InChI=1S/C10H13NO4/c1-12-7-3-6(4-11)8(13-2)10-9(7)14-5-15-10/h3H,4-5,11H2,1-2H3 |
| InChIKey | JWWLOGFPHCXLLW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine?
The IUPAC name of (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine (CID 42647358) is (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine.
What is the SMILES notation for (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine?
The canonical SMILES for (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine is COc1cc(CN)c(OC)c2c1OCO2.
What is the InChIKey of (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine?
The InChIKey is JWWLOGFPHCXLLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c1-12-7-3-6(4-11)8(13-2)10-9(7)14-5-15-10/h3H,4-5,11H2,1-2H3.
What are the key properties of (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine?
(4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine has a molecular weight of 211.22 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine is sourced from PubChem (CID 42647358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).