About 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile
3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile (PubChem CID 42647376) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile |
| PubChem CID | 42647376 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile |
| SMILES | COc1ccc(C2=NOC(C#N)C2)cc1 |
| InChI | InChI=1S/C11H10N2O2/c1-14-9-4-2-8(3-5-9)11-6-10(7-12)15-13-11/h2-5,10H,6H2,1H3 |
| InChIKey | OFDJXHCEZKNLKF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The IUPAC name of 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile (CID 42647376) is 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile.
What is the SMILES notation for 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The canonical SMILES for 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile is COc1ccc(C2=NOC(C#N)C2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The InChIKey is OFDJXHCEZKNLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-14-9-4-2-8(3-5-9)11-6-10(7-12)15-13-11/h2-5,10H,6H2,1H3.
What are the key properties of 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile?
3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile has a molecular weight of 202.21 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile is sourced from PubChem (CID 42647376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).