About 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile
3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile (PubChem CID 42647384) has the molecular formula C10H7FN2O
and a molecular weight of 190.18 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile |
| PubChem CID | 42647384 |
| Molecular Formula | C10H7FN2O |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile |
| SMILES | N#CC1CC(c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C10H7FN2O/c11-8-3-1-7(2-4-8)10-5-9(6-12)14-13-10/h1-4,9H,5H2 |
| InChIKey | MCAQGWFDFHCMPC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The IUPAC name of 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile (CID 42647384) is 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile.
What is the SMILES notation for 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The canonical SMILES for 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile is N#CC1CC(c2ccc(F)cc2)=NO1.
What is the InChIKey of 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile?
The InChIKey is MCAQGWFDFHCMPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2O/c11-8-3-1-7(2-4-8)10-5-9(6-12)14-13-10/h1-4,9H,5H2.
What are the key properties of 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile?
3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile has a molecular weight of 190.18 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonitrile is sourced from PubChem (CID 42647384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).