C18H17NO3S — CID 42647449
4-(2-oxo-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-4-yl)benzoic acid (PubChem CID 42647449) has the molecular formula C18H17NO3S and a molecular weight of 327.40 g/mol. Its IUPAC name is 4-(2-oxo-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-4-yl)benzoic acid.
| Compound Name | 4-(2-oxo-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 42647449 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-(2-oxo-3,4,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-b]pyridin-4-yl)benzoic acid |
| SMILES | O=C1CC(c2ccc(C(=O)O)cc2)c2c(sc3c2CCCC3)N1 |
| InChI | InChI=1S/C18H17NO3S/c20-15-9-13(10-5-7-11(8-6-10)18(21)22)16-12-3-1-2-4-14(12)23-17(16)19-15/h5-8,13H,1-4,9H2,(H,19,20)(H,21,22) |
| InChIKey | YTZPSRRECXHMIO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |