C12H16N2O4S2 — CID 42647575
1,4-bis(1,2-oxazol-3-ylmethylsulfanyl)butane-2,3-diol (PubChem CID 42647575) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1,4-bis(1,2-oxazol-3-ylmethylsulfanyl)butane-2,3-diol.
| Compound Name | 1,4-bis(1,2-oxazol-3-ylmethylsulfanyl)butane-2,3-diol |
|---|---|
| PubChem CID | 42647575 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1,4-bis(1,2-oxazol-3-ylmethylsulfanyl)butane-2,3-diol |
| SMILES | OC(CSCc1ccon1)C(O)CSCc1ccon1 |
| InChI | InChI=1S/C12H16N2O4S2/c15-11(7-19-5-9-1-3-17-13-9)12(16)8-20-6-10-2-4-18-14-10/h1-4,11-12,15-16H,5-8H2 |
| InChIKey | GZMCKUJVIPGXBF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |