C12H13ClN4O — CID 42647714
2-chloro-6-methoxy-5,5,6-trimethyl-1H-pyridine-3,4,4-tricarbonitrile (PubChem CID 42647714) has the molecular formula C12H13ClN4O and a molecular weight of 264.72 g/mol. Its IUPAC name is 2-chloro-6-methoxy-5,5,6-trimethyl-1H-pyridine-3,4,4-tricarbonitrile.
| Compound Name | 2-chloro-6-methoxy-5,5,6-trimethyl-1H-pyridine-3,4,4-tricarbonitrile |
|---|---|
| PubChem CID | 42647714 |
| Molecular Formula | C12H13ClN4O |
| Molecular Weight | 264.72 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-chloro-6-methoxy-5,5,6-trimethyl-1H-pyridine-3,4,4-tricarbonitrile |
| SMILES | COC1(C)NC(Cl)=C(C#N)C(C#N)(C#N)C1(C)C |
| InChI | InChI=1S/C12H13ClN4O/c1-10(2)11(3,18-4)17-9(13)8(5-14)12(10,6-15)7-16/h17H,1-4H3 |
| InChIKey | ASWIEYRHQVFTGR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.72 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|