About [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone
[3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 42647803) has the molecular formula C23H20N2O4S
and a molecular weight of 420.49 g/mol. Its IUPAC name is [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone.
Molecular Properties
| Compound Name | [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone |
| PubChem CID | 42647803 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2sc3nc(-c4ccccc4OC)ccc3c2N)cc1OC |
| InChI | InChI=1S/C23H20N2O4S/c1-27-17-7-5-4-6-14(17)16-10-9-15-20(24)22(30-23(15)25-16)21(26)13-8-11-18(28-2)19(12-13)29-3/h4-12H,24H2,1-3H3 |
| InChIKey | HAMSRRJHMKWRPI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone?
The IUPAC name of [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone (CID 42647803) is [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone.
What is the SMILES notation for [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone?
The canonical SMILES for [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone is COc1ccc(C(=O)c2sc3nc(-c4ccccc4OC)ccc3c2N)cc1OC.
What is the InChIKey of [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone?
The InChIKey is HAMSRRJHMKWRPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O4S/c1-27-17-7-5-4-6-14(17)16-10-9-15-20(24)22(30-23(15)25-16)21(26)13-8-11-18(28-2)19(12-13)29-3/h4-12H,24H2,1-3H3.
What are the key properties of [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone?
[3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone has a molecular weight of 420.49 g/mol, XLogP of 4.80, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-6-(2-methoxyphenyl)thieno[2,3-b]pyridin-2-yl]-(3,4-dimethoxyphenyl)methanone is sourced from PubChem (CID 42647803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).