C14H7N5O3 — CID 42647818
4-(3-nitrophenyl)-4-oxobutane-1,1,2,2-tetracarbonitrile (PubChem CID 42647818) has the molecular formula C14H7N5O3 and a molecular weight of 293.24 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-4-oxobutane-1,1,2,2-tetracarbonitrile.
| Compound Name | 4-(3-nitrophenyl)-4-oxobutane-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 42647818 |
| Molecular Formula | C14H7N5O3 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-(3-nitrophenyl)-4-oxobutane-1,1,2,2-tetracarbonitrile |
| SMILES | N#CC(C#N)C(C#N)(C#N)CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H7N5O3/c15-6-11(7-16)14(8-17,9-18)5-13(20)10-2-1-3-12(4-10)19(21)22/h1-4,11H,5H2 |
| InChIKey | NXFLHPYIOBSMEN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 155.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|