C12H10FN3OSe — CID 42647997
2-amino-7-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]selenazolo[4,5-b]pyridin-5-one (PubChem CID 42647997) has the molecular formula C12H10FN3OSe and a molecular weight of 310.19 g/mol. Its IUPAC name is 2-amino-7-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]selenazolo[4,5-b]pyridin-5-one.
| Compound Name | 2-amino-7-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]selenazolo[4,5-b]pyridin-5-one |
|---|---|
| PubChem CID | 42647997 |
| Molecular Formula | C12H10FN3OSe |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | 2-amino-7-(4-fluorophenyl)-6,7-dihydro-4H-[1,3]selenazolo[4,5-b]pyridin-5-one |
| SMILES | Nc1nc2c([se]1)C(c1ccc(F)cc1)CC(=O)N2 |
| InChI | InChI=1S/C12H10FN3OSe/c13-7-3-1-6(2-4-7)8-5-9(17)15-11-10(8)18-12(14)16-11/h1-4,8H,5H2,(H2,14,16)(H,15,17) |
| InChIKey | RLMXESCRKCKQTH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|