C19H17N3O2S — CID 42648366
5-(2-hydroxyethyl)-11,13-dimethyl-4-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 42648366) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-11,13-dimethyl-4-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 5-(2-hydroxyethyl)-11,13-dimethyl-4-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 42648366 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 5-(2-hydroxyethyl)-11,13-dimethyl-4-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | Cc1cc(C)c2c(n1)sc1c(=O)n(CCO)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C19H17N3O2S/c1-11-10-12(2)20-18-14(11)15-16(25-18)19(24)22(8-9-23)17(21-15)13-6-4-3-5-7-13/h3-7,10,23H,8-9H2,1-2H3 |
| InChIKey | OWZHYJPCYZKJDM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |