C14H16N2O2 — CID 42648389
6-hydroxy-6-methyl-4-phenyl-2,4,5,7-tetrahydro-1H-indazol-3-one (PubChem CID 42648389) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 6-hydroxy-6-methyl-4-phenyl-2,4,5,7-tetrahydro-1H-indazol-3-one.
| Compound Name | 6-hydroxy-6-methyl-4-phenyl-2,4,5,7-tetrahydro-1H-indazol-3-one |
|---|---|
| PubChem CID | 42648389 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 6-hydroxy-6-methyl-4-phenyl-2,4,5,7-tetrahydro-1H-indazol-3-one |
| SMILES | CC1(O)Cc2[nH][nH]c(=O)c2C(c2ccccc2)C1 |
| InChI | InChI=1S/C14H16N2O2/c1-14(18)7-10(9-5-3-2-4-6-9)12-11(8-14)15-16-13(12)17/h2-6,10,18H,7-8H2,1H3,(H2,15,16,17) |
| InChIKey | UXNHNQWNKCHOIN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |